![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/a.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| compilation.eps | 2000-12-05 15:56 | 8.0K | |
| compilation.fig | 2000-12-05 15:56 | 1.6K | |
| doc-examples/ | 2003-03-21 13:31 | - | |
| prosper-doc.pdf | 2003-02-21 19:32 | 183K | |
| prosper-doc.tex | 2003-02-21 19:33 | 26K | |
| prosper-structure.eps | 2003-02-21 19:33 | 7.6K | |
| prosper-structure.fig | 2003-02-21 19:33 | 3.9K | |
| prosper-tour.pdf | 2001-06-29 12:18 | 131K | |
| prosper-tour.tex | 2001-01-23 00:00 | 7.7K | |
| rotation.ps | 2000-11-28 12:15 | 13K | |
| rotation.tex | 2000-11-28 12:15 | 413 | |